C27H34N2O5 — CID 102274053
2,6-bis[[2-hydroxyethyl-[(2-hydroxyphenyl)methyl]amino]methyl]-4-methylphenol (PubChem CID 102274053) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2,6-bis[[2-hydroxyethyl-[(2-hydroxyphenyl)methyl]amino]methyl]-4-methylphenol.
| Compound Name | 2,6-bis[[2-hydroxyethyl-[(2-hydroxyphenyl)methyl]amino]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 102274053 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 2,6-bis[[2-hydroxyethyl-[(2-hydroxyphenyl)methyl]amino]methyl]-4-methylphenol |
| SMILES | Cc1cc(CN(CCO)Cc2ccccc2O)c(O)c(CN(CCO)Cc2ccccc2O)c1 |
| InChI | InChI=1S/C27H34N2O5/c1-20-14-23(18-28(10-12-30)16-21-6-2-4-8-25(21)32)27(34)24(15-20)19-29(11-13-31)17-22-7-3-5-9-26(22)33/h2-9,14-15,30-34H,10-13,16-19H2,1H3 |
| InChIKey | MCAIMIKFGPLVOA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|