C17H29N2O5- — CID 101432841
2,6-bis[[bis(2-hydroxyethyl)amino]methyl]-4-methylphenolate (PubChem CID 101432841) has the molecular formula C17H29N2O5- and a molecular weight of 341.43 g/mol. Its IUPAC name is 2,6-bis[[bis(2-hydroxyethyl)amino]methyl]-4-methylphenolate.
| Compound Name | 2,6-bis[[bis(2-hydroxyethyl)amino]methyl]-4-methylphenolate |
|---|---|
| PubChem CID | 101432841 |
| Molecular Formula | C17H29N2O5- |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2,6-bis[[bis(2-hydroxyethyl)amino]methyl]-4-methylphenolate |
| SMILES | Cc1cc(CN(CCO)CCO)c([O-])c(CN(CCO)CCO)c1 |
| InChI | InChI=1S/C17H30N2O5/c1-14-10-15(12-18(2-6-20)3-7-21)17(24)16(11-14)13-19(4-8-22)5-9-23/h10-11,20-24H,2-9,12-13H2,1H3/p-1 |
| InChIKey | LQQPEYLPMQJEDN-UHFFFAOYSA-M |
| XLogP | -1.36 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |