C21H25F2NO3 — CID 93164175
[(2S)-3-[(2-fluorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate (PubChem CID 93164175) has the molecular formula C21H25F2NO3 and a molecular weight of 377.43 g/mol. Its IUPAC name is [(2S)-3-[(2-fluorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate.
| Compound Name | [(2S)-3-[(2-fluorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate |
|---|---|
| PubChem CID | 93164175 |
| Molecular Formula | C21H25F2NO3 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | [(2S)-3-[(2-fluorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate |
| SMILES | CCCC(=O)OC[C@@H](O)CN(Cc1ccc(F)cc1)Cc1ccccc1F |
| InChI | InChI=1S/C21H25F2NO3/c1-2-5-21(26)27-15-19(25)14-24(12-16-8-10-18(22)11-9-16)13-17-6-3-4-7-20(17)23/h3-4,6-11,19,25H,2,5,12-15H2,1H3/t19-/m0/s1 |
| InChIKey | NFWZXWDMHMFGMN-IBGZPJMESA-N |
| XLogP | 3.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |