C22H30N2O3S — CID 93165371
(2S)-N-[(1R)-3-methyl-1-phenylbutyl]-2-(N-methylsulfonylanilino)butanamide (PubChem CID 93165371) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is (2S)-N-[(1R)-3-methyl-1-phenylbutyl]-2-(N-methylsulfonylanilino)butanamide.
| Compound Name | (2S)-N-[(1R)-3-methyl-1-phenylbutyl]-2-(N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 93165371 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (2S)-N-[(1R)-3-methyl-1-phenylbutyl]-2-(N-methylsulfonylanilino)butanamide |
| SMILES | CC[C@@H](C(=O)N[C@H](CC(C)C)c1ccccc1)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H30N2O3S/c1-5-21(24(28(4,26)27)19-14-10-7-11-15-19)22(25)23-20(16-17(2)3)18-12-8-6-9-13-18/h6-15,17,20-21H,5,16H2,1-4H3,(H,23,25)/t20-,21+/m1/s1 |
| InChIKey | CCKCGSIIALXXBE-RTWAWAEBSA-N |
| XLogP | 4.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |