C20H25ClN2O3S — CID 94016258
(2R)-2-(3-chloro-N-methylsulfonylanilino)-N-[(1S)-1-phenylpropyl]butanamide (PubChem CID 94016258) has the molecular formula C20H25ClN2O3S and a molecular weight of 408.95 g/mol. Its IUPAC name is (2R)-2-(3-chloro-N-methylsulfonylanilino)-N-[(1S)-1-phenylpropyl]butanamide.
| Compound Name | (2R)-2-(3-chloro-N-methylsulfonylanilino)-N-[(1S)-1-phenylpropyl]butanamide |
|---|---|
| PubChem CID | 94016258 |
| Molecular Formula | C20H25ClN2O3S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (2R)-2-(3-chloro-N-methylsulfonylanilino)-N-[(1S)-1-phenylpropyl]butanamide |
| SMILES | CC[C@H](NC(=O)[C@@H](CC)N(c1cccc(Cl)c1)S(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C20H25ClN2O3S/c1-4-18(15-10-7-6-8-11-15)22-20(24)19(5-2)23(27(3,25)26)17-13-9-12-16(21)14-17/h6-14,18-19H,4-5H2,1-3H3,(H,22,24)/t18-,19+/m0/s1 |
| InChIKey | SYUNKRHRUDIBEE-RBUKOAKNSA-N |
| XLogP | 4.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |