C15H15N5O — CID 931674
(5R,7R)-7-(furan-2-yl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 931674) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is (5R,7R)-7-(furan-2-yl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | (5R,7R)-7-(furan-2-yl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 931674 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (5R,7R)-7-(furan-2-yl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Nc1nc2n(n1)[C@@H](c1ccco1)C[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C15H15N5O/c16-14-18-15-17-11(10-5-2-1-3-6-10)9-12(20(15)19-14)13-7-4-8-21-13/h1-8,11-12H,9H2,(H3,16,17,18,19)/t11-,12-/m1/s1 |
| InChIKey | WJIRJQFMVJJDGX-VXGBXAGGSA-N |
| XLogP | 2.60 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |