C14H11F3N4O — CID 93206142
2-methoxy-5-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline (PubChem CID 93206142) has the molecular formula C14H11F3N4O and a molecular weight of 308.26 g/mol. Its IUPAC name is 2-methoxy-5-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline.
| Compound Name | 2-methoxy-5-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline |
|---|---|
| PubChem CID | 93206142 |
| Molecular Formula | C14H11F3N4O |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-methoxy-5-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]aniline |
| SMILES | COc1ccc(-c2nnc3ccc(C(F)(F)F)cn23)cc1N |
| InChI | InChI=1S/C14H11F3N4O/c1-22-11-4-2-8(6-10(11)18)13-20-19-12-5-3-9(7-21(12)13)14(15,16)17/h2-7H,18H2,1H3 |
| InChIKey | CAPMXVGUOVMPTQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|