C23H24N2O6S — CID 93207373
N-(3,4-dimethoxyphenyl)-N-[(1S)-1-(3-methylphenyl)ethyl]-4-nitrobenzenesulfonamide (PubChem CID 93207373) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-[(1S)-1-(3-methylphenyl)ethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-[(1S)-1-(3-methylphenyl)ethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 93207373 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-[(1S)-1-(3-methylphenyl)ethyl]-4-nitrobenzenesulfonamide |
| SMILES | COc1ccc(N([C@@H](C)c2cccc(C)c2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C23H24N2O6S/c1-16-6-5-7-18(14-16)17(2)24(20-10-13-22(30-3)23(15-20)31-4)32(28,29)21-11-8-19(9-12-21)25(26)27/h5-15,17H,1-4H3/t17-/m0/s1 |
| InChIKey | JARNEVHGKTUMHD-KRWDZBQOSA-N |
| XLogP | 4.88 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|