C18H23ClN4O5 — CID 9321254
4-(4-acetylpiperazin-1-yl)-N'-[2-(2-chlorophenoxy)acetyl]-4-oxobutanehydrazide (PubChem CID 9321254) has the molecular formula C18H23ClN4O5 and a molecular weight of 410.86 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N'-[2-(2-chlorophenoxy)acetyl]-4-oxobutanehydrazide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N'-[2-(2-chlorophenoxy)acetyl]-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 9321254 |
| Molecular Formula | C18H23ClN4O5 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N'-[2-(2-chlorophenoxy)acetyl]-4-oxobutanehydrazide |
| SMILES | CC(=O)N1CCN(C(=O)CCC(=O)NNC(=O)COc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H23ClN4O5/c1-13(24)22-8-10-23(11-9-22)18(27)7-6-16(25)20-21-17(26)12-28-15-5-3-2-4-14(15)19/h2-5H,6-12H2,1H3,(H,20,25)(H,21,26) |
| InChIKey | SPPFKSKSKOFOBZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|