C30H41N3O4 — CID 93222761
(2S)-1-butoxy-3-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]propan-2-ol (PubChem CID 93222761) has the molecular formula C30H41N3O4 and a molecular weight of 507.68 g/mol. Its IUPAC name is (2S)-1-butoxy-3-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]propan-2-ol.
| Compound Name | (2S)-1-butoxy-3-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 93222761 |
| Molecular Formula | C30H41N3O4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | (2S)-1-butoxy-3-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]propan-2-ol |
| SMILES | CCCCOC[C@@H](O)CN(Cc1c(CC)nn(-c2ccccc2)c1Oc1ccccc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C30H41N3O4/c1-3-5-18-35-23-25(34)20-32(21-27-17-12-19-36-27)22-28-29(4-2)31-33(24-13-8-6-9-14-24)30(28)37-26-15-10-7-11-16-26/h6-11,13-16,25,27,34H,3-5,12,17-23H2,1-2H3/t25-,27-/m0/s1 |
| InChIKey | PSLGIHCJIOLPNM-BDYUSTAISA-N |
| XLogP | 5.39 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|