C18H18Cl2N2O4 — CID 9322281
3,5-dichloro-N'-[2-(3,5-dimethylphenoxy)acetyl]-4-methoxybenzohydrazide (PubChem CID 9322281) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is 3,5-dichloro-N'-[2-(3,5-dimethylphenoxy)acetyl]-4-methoxybenzohydrazide.
| Compound Name | 3,5-dichloro-N'-[2-(3,5-dimethylphenoxy)acetyl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 9322281 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 3,5-dichloro-N'-[2-(3,5-dimethylphenoxy)acetyl]-4-methoxybenzohydrazide |
| SMILES | COc1c(Cl)cc(C(=O)NNC(=O)COc2cc(C)cc(C)c2)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-10-4-11(2)6-13(5-10)26-9-16(23)21-22-18(24)12-7-14(19)17(25-3)15(20)8-12/h4-8H,9H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | DDAPNDKQQWXQGR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|