C23H20ClN3O5 — CID 93225477
(3aR,4R,8aR,8bS)-2-(4-chloro-3-nitrophenyl)-4-(4-methylbenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 93225477) has the molecular formula C23H20ClN3O5 and a molecular weight of 453.88 g/mol. Its IUPAC name is (3aR,4R,8aR,8bS)-2-(4-chloro-3-nitrophenyl)-4-(4-methylbenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aR,4R,8aR,8bS)-2-(4-chloro-3-nitrophenyl)-4-(4-methylbenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 93225477 |
| Molecular Formula | C23H20ClN3O5 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (3aR,4R,8aR,8bS)-2-(4-chloro-3-nitrophenyl)-4-(4-methylbenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | Cc1ccc(C(=O)[C@H]2[C@@H]3C(=O)N(c4ccc(Cl)c([N+](=O)[O-])c4)C(=O)[C@@H]3[C@H]3CCCN32)cc1 |
| InChI | InChI=1S/C23H20ClN3O5/c1-12-4-6-13(7-5-12)21(28)20-19-18(16-3-2-10-25(16)20)22(29)26(23(19)30)14-8-9-15(24)17(11-14)27(31)32/h4-9,11,16,18-20H,2-3,10H2,1H3/t16-,18-,19-,20-/m1/s1 |
| InChIKey | XMUPEQLYMANZPM-VBSBHUPXSA-N |
| XLogP | 3.39 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|