C29H33FN4O2 — CID 93226430
(2S)-1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-prop-2-ynoxypropan-2-ol (PubChem CID 93226430) has the molecular formula C29H33FN4O2 and a molecular weight of 488.61 g/mol. Its IUPAC name is (2S)-1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | (2S)-1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 93226430 |
| Molecular Formula | C29H33FN4O2 |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | (2S)-1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOC[C@@H](O)CN1CCN(c2nc(-c3ccccc3)nc(CC)c2Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C29H33FN4O2/c1-3-18-36-21-24(35)20-33-14-16-34(17-15-33)29-25(19-23-12-8-9-13-26(23)30)27(4-2)31-28(32-29)22-10-6-5-7-11-22/h1,5-13,24,35H,4,14-21H2,2H3/t24-/m0/s1 |
| InChIKey | YFSJOVICKKPWOK-DEOSSOPVSA-N |
| XLogP | 3.57 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|