C29H35FN4O2 — CID 46029755
1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-prop-2-enoxypropan-2-ol (PubChem CID 46029755) has the molecular formula C29H35FN4O2 and a molecular weight of 490.62 g/mol. Its IUPAC name is 1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 46029755 |
| Molecular Formula | C29H35FN4O2 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)CN1CCN(c2nc(-c3ccccc3)nc(CC)c2Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C29H35FN4O2/c1-3-18-36-21-24(35)20-33-14-16-34(17-15-33)29-25(19-23-12-8-9-13-26(23)30)27(4-2)31-28(32-29)22-10-6-5-7-11-22/h3,5-13,24,35H,1,4,14-21H2,2H3 |
| InChIKey | UWMDKYHKEVPXLY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|