C23H31FN4O — CID 42844320
1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-methylpyrimidin-4-yl]piperazin-1-yl]-2-methylbut-3-en-2-ol (PubChem CID 42844320) has the molecular formula C23H31FN4O and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-methylpyrimidin-4-yl]piperazin-1-yl]-2-methylbut-3-en-2-ol.
| Compound Name | 1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-methylpyrimidin-4-yl]piperazin-1-yl]-2-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 42844320 |
| Molecular Formula | C23H31FN4O |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1-[4-[6-ethyl-5-[(2-fluorophenyl)methyl]-2-methylpyrimidin-4-yl]piperazin-1-yl]-2-methylbut-3-en-2-ol |
| SMILES | C=CC(C)(O)CN1CCN(c2nc(C)nc(CC)c2Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C23H31FN4O/c1-5-21-19(15-18-9-7-8-10-20(18)24)22(26-17(3)25-21)28-13-11-27(12-14-28)16-23(4,29)6-2/h6-10,29H,2,5,11-16H2,1,3-4H3 |
| InChIKey | CBSBFPCMMSZWNW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|