C23H23N3O3S — CID 9325769
1-[[(E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoyl]amino]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 9325769) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-[[(E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoyl]amino]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[[(E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoyl]amino]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 9325769 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-[[(E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoyl]amino]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)NNC(=O)/C=C/c2ccc3cc(OC)ccc3c2)cc1 |
| InChI | InChI=1S/C23H23N3O3S/c1-28-20-9-4-17(5-10-20)15-24-23(30)26-25-22(27)12-6-16-3-7-19-14-21(29-2)11-8-18(19)13-16/h3-14H,15H2,1-2H3,(H,25,27)(H2,24,26,30)/b12-6+ |
| InChIKey | COYIQEUCGAESFV-WUXMJOGZSA-N |
| XLogP | 3.57 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|