C12H17NO2 — CID 93280068
(2R)-2-(methylamino)-2-(4-propan-2-ylphenyl)acetic acid (PubChem CID 93280068) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (2R)-2-(methylamino)-2-(4-propan-2-ylphenyl)acetic acid.
| Compound Name | (2R)-2-(methylamino)-2-(4-propan-2-ylphenyl)acetic acid |
|---|---|
| PubChem CID | 93280068 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (2R)-2-(methylamino)-2-(4-propan-2-ylphenyl)acetic acid |
| SMILES | CN[C@@H](C(=O)O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C12H17NO2/c1-8(2)9-4-6-10(7-5-9)11(13-3)12(14)15/h4-8,11,13H,1-3H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | NHJQWKXUUCZCQR-LLVKDONJSA-N |
| XLogP | 2.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |