C8H12ClNO2 — CID 93288931
(1R,2R,3S,4S)-2-amino-3-chlorobicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 93288931) has the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. Its IUPAC name is (1R,2R,3S,4S)-2-amino-3-chlorobicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,2R,3S,4S)-2-amino-3-chlorobicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 93288931 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (1R,2R,3S,4S)-2-amino-3-chlorobicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | N[C@@]1(C(=O)O)[C@@H]2CC[C@@H](C2)[C@@H]1Cl |
| InChI | InChI=1S/C8H12ClNO2/c9-6-4-1-2-5(3-4)8(6,10)7(11)12/h4-6H,1-3,10H2,(H,11,12)/t4-,5+,6-,8-/m0/s1 |
| InChIKey | ADCLTCKSXCLVBV-GCJQMDKQSA-N |
| XLogP | 0.81 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|