C17H22N4O3S — CID 9329210
3-(3-methoxypropyl)-1-methyl-1-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]thiourea (PubChem CID 9329210) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-1-methyl-1-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]thiourea.
| Compound Name | 3-(3-methoxypropyl)-1-methyl-1-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 9329210 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-(3-methoxypropyl)-1-methyl-1-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]thiourea |
| SMILES | COCCCNC(=S)N(C)NC(=O)c1c(-c2ccccc2)noc1C |
| InChI | InChI=1S/C17H22N4O3S/c1-12-14(15(20-24-12)13-8-5-4-6-9-13)16(22)19-21(2)17(25)18-10-7-11-23-3/h4-6,8-9H,7,10-11H2,1-3H3,(H,18,25)(H,19,22) |
| InChIKey | LNHWUSHDHDLVMP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|