C18H20N2O3S — CID 93292435
(3R)-1-(4-ethoxyphenyl)-3-methyl-4-(thiophene-2-carbonyl)piperazin-2-one (PubChem CID 93292435) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is (3R)-1-(4-ethoxyphenyl)-3-methyl-4-(thiophene-2-carbonyl)piperazin-2-one.
| Compound Name | (3R)-1-(4-ethoxyphenyl)-3-methyl-4-(thiophene-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 93292435 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (3R)-1-(4-ethoxyphenyl)-3-methyl-4-(thiophene-2-carbonyl)piperazin-2-one |
| SMILES | CCOc1ccc(N2CCN(C(=O)c3cccs3)[C@H](C)C2=O)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-3-23-15-8-6-14(7-9-15)20-11-10-19(13(2)17(20)21)18(22)16-5-4-12-24-16/h4-9,12-13H,3,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | IWAAIPHXMBBMFV-CYBMUJFWSA-N |
| XLogP | 3.02 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |