C22H20N2O3S — CID 93292450
(3S)-3-methyl-1-(4-phenoxyphenyl)-4-(thiophene-2-carbonyl)piperazin-2-one (PubChem CID 93292450) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is (3S)-3-methyl-1-(4-phenoxyphenyl)-4-(thiophene-2-carbonyl)piperazin-2-one.
| Compound Name | (3S)-3-methyl-1-(4-phenoxyphenyl)-4-(thiophene-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 93292450 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (3S)-3-methyl-1-(4-phenoxyphenyl)-4-(thiophene-2-carbonyl)piperazin-2-one |
| SMILES | C[C@H]1C(=O)N(c2ccc(Oc3ccccc3)cc2)CCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C22H20N2O3S/c1-16-21(25)24(14-13-23(16)22(26)20-8-5-15-28-20)17-9-11-19(12-10-17)27-18-6-3-2-4-7-18/h2-12,15-16H,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | IFEAAAQORNCRKC-INIZCTEOSA-N |
| XLogP | 4.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |