C24H19N3O2S — CID 9329493
4-[[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzonitrile (PubChem CID 9329493) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is 4-[[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzonitrile.
| Compound Name | 4-[[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 9329493 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-[[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzonitrile |
| SMILES | CCOc1ccccc1-n1c(SCc2ccc(C#N)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H19N3O2S/c1-2-29-22-10-6-5-9-21(22)27-23(28)19-7-3-4-8-20(19)26-24(27)30-16-18-13-11-17(15-25)12-14-18/h3-14H,2,16H2,1H3 |
| InChIKey | OWPPHSICFSSHPY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |