C20H24ClFN4O2 — CID 93296445
3-chloro-1-[(2S)-4-[6-(2-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 93296445) has the molecular formula C20H24ClFN4O2 and a molecular weight of 406.89 g/mol. Its IUPAC name is 3-chloro-1-[(2S)-4-[6-(2-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-[(2S)-4-[6-(2-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 93296445 |
| Molecular Formula | C20H24ClFN4O2 |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-chloro-1-[(2S)-4-[6-(2-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | C[C@H]1CN(c2cc(Oc3ccccc3F)ncn2)CCN1C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C20H24ClFN4O2/c1-14-11-25(8-9-26(14)19(27)20(2,3)12-21)17-10-18(24-13-23-17)28-16-7-5-4-6-15(16)22/h4-7,10,13-14H,8-9,11-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | YGKDYGCFPGPBCM-AWEZNQCLSA-N |
| XLogP | 3.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|