C19H23ClN4O2 — CID 98754852
(2S)-2-chloro-1-[(2R)-2-methyl-4-[6-(2-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]propan-1-one (PubChem CID 98754852) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is (2S)-2-chloro-1-[(2R)-2-methyl-4-[6-(2-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]propan-1-one.
| Compound Name | (2S)-2-chloro-1-[(2R)-2-methyl-4-[6-(2-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 98754852 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2S)-2-chloro-1-[(2R)-2-methyl-4-[6-(2-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]propan-1-one |
| SMILES | Cc1ccccc1Oc1cc(N2CCN(C(=O)[C@H](C)Cl)[C@H](C)C2)ncn1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-13-6-4-5-7-16(13)26-18-10-17(21-12-22-18)23-8-9-24(14(2)11-23)19(25)15(3)20/h4-7,10,12,14-15H,8-9,11H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | CKLLFLJPNPFRDG-CABCVRRESA-N |
| XLogP | 3.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|