C21H26N4O2 — CID 93340681
cyclobutyl-[(2S)-2-methyl-4-[6-(2-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 93340681) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is cyclobutyl-[(2S)-2-methyl-4-[6-(2-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | cyclobutyl-[(2S)-2-methyl-4-[6-(2-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 93340681 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | cyclobutyl-[(2S)-2-methyl-4-[6-(2-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | Cc1ccccc1Oc1cc(N2CCN(C(=O)C3CCC3)[C@@H](C)C2)ncn1 |
| InChI | InChI=1S/C21H26N4O2/c1-15-6-3-4-9-18(15)27-20-12-19(22-14-23-20)24-10-11-25(16(2)13-24)21(26)17-7-5-8-17/h3-4,6,9,12,14,16-17H,5,7-8,10-11,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | YALLCYWCJDLYFM-INIZCTEOSA-N |
| XLogP | 3.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |