C22H28N4O2 — CID 83287920
cyclopentyl-[2-methyl-4-[6-(3-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 83287920) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is cyclopentyl-[2-methyl-4-[6-(3-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | cyclopentyl-[2-methyl-4-[6-(3-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 83287920 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | cyclopentyl-[2-methyl-4-[6-(3-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | Cc1cccc(Oc2cc(N3CCN(C(=O)C4CCCC4)C(C)C3)ncn2)c1 |
| InChI | InChI=1S/C22H28N4O2/c1-16-6-5-9-19(12-16)28-21-13-20(23-15-24-21)25-10-11-26(17(2)14-25)22(27)18-7-3-4-8-18/h5-6,9,12-13,15,17-18H,3-4,7-8,10-11,14H2,1-2H3 |
| InChIKey | WVZAEKMTBPDPFE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |