C18H22FN5O2 — CID 83282349
N-ethyl-4-[6-(3-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazine-1-carboxamide (PubChem CID 83282349) has the molecular formula C18H22FN5O2 and a molecular weight of 359.41 g/mol. Its IUPAC name is N-ethyl-4-[6-(3-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazine-1-carboxamide.
| Compound Name | N-ethyl-4-[6-(3-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 83282349 |
| Molecular Formula | C18H22FN5O2 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-ethyl-4-[6-(3-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(c2cc(Oc3cccc(F)c3)ncn2)CC1C |
| InChI | InChI=1S/C18H22FN5O2/c1-3-20-18(25)24-8-7-23(11-13(24)2)16-10-17(22-12-21-16)26-15-6-4-5-14(19)9-15/h4-6,9-10,12-13H,3,7-8,11H2,1-2H3,(H,20,25) |
| InChIKey | GHKHLVCOTRHRNQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |