C22H22FN5O3 — CID 93296720
4-(3-fluorophenoxy)-6-[(3S)-3-methyl-4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine (PubChem CID 93296720) has the molecular formula C22H22FN5O3 and a molecular weight of 423.45 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-6-[(3S)-3-methyl-4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine.
| Compound Name | 4-(3-fluorophenoxy)-6-[(3S)-3-methyl-4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 93296720 |
| Molecular Formula | C22H22FN5O3 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 4-(3-fluorophenoxy)-6-[(3S)-3-methyl-4-[(3-nitrophenyl)methyl]piperazin-1-yl]pyrimidine |
| SMILES | C[C@H]1CN(c2cc(Oc3cccc(F)c3)ncn2)CCN1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22FN5O3/c1-16-13-27(9-8-26(16)14-17-4-2-6-19(10-17)28(29)30)21-12-22(25-15-24-21)31-20-7-3-5-18(23)11-20/h2-7,10-12,15-16H,8-9,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | CHCROBPCRPLFQH-INIZCTEOSA-N |
| XLogP | 4.03 |
| TPSA | 84.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|