C10H18O4 — CID 933026
(1S,3R,4S,6S)-1,3,4,6-tetramethyl-2,5-dioxabicyclo[2.2.2]octane-3,6-diol (PubChem CID 933026) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1S,3R,4S,6S)-1,3,4,6-tetramethyl-2,5-dioxabicyclo[2.2.2]octane-3,6-diol.
| Compound Name | (1S,3R,4S,6S)-1,3,4,6-tetramethyl-2,5-dioxabicyclo[2.2.2]octane-3,6-diol |
|---|---|
| PubChem CID | 933026 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (1S,3R,4S,6S)-1,3,4,6-tetramethyl-2,5-dioxabicyclo[2.2.2]octane-3,6-diol |
| SMILES | C[C@]1(O)O[C@@]2(C)CC[C@]1(C)O[C@@]2(C)O |
| InChI | InChI=1S/C10H18O4/c1-7-5-6-8(2,10(4,12)13-7)14-9(7,3)11/h11-12H,5-6H2,1-4H3/t7-,8-,9-,10+/m0/s1 |
| InChIKey | XXGORDDKAZGANR-AATLWQCWSA-N |
| XLogP | 0.76 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |