C23H27FN2O2+2 — CID 9330494
1-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]naphthalen-2-ol (PubChem CID 9330494) has the molecular formula C23H27FN2O2+2 and a molecular weight of 382.48 g/mol. Its IUPAC name is 1-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]naphthalen-2-ol.
| Compound Name | 1-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 9330494 |
| Molecular Formula | C23H27FN2O2+2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]naphthalen-2-ol |
| SMILES | COc1ccc(F)cc1C[NH+]1CC[NH+](Cc2c(O)ccc3ccccc23)CC1 |
| InChI | InChI=1S/C23H25FN2O2/c1-28-23-9-7-19(24)14-18(23)15-25-10-12-26(13-11-25)16-21-20-5-3-2-4-17(20)6-8-22(21)27/h2-9,14,27H,10-13,15-16H2,1H3/p+2 |
| InChIKey | MZGMHGNXUIQCJJ-UHFFFAOYSA-P |
| XLogP | 1.18 |
| TPSA | 38.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|