C10H13BrN2O2 — CID 93318154
4-bromo-N-[[(3S)-oxolan-3-yl]methyl]-1H-pyrrole-2-carboxamide (PubChem CID 93318154) has the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. Its IUPAC name is 4-bromo-N-[[(3S)-oxolan-3-yl]methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[[(3S)-oxolan-3-yl]methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 93318154 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 4-bromo-N-[[(3S)-oxolan-3-yl]methyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CCOC1)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C10H13BrN2O2/c11-8-3-9(12-5-8)10(14)13-4-7-1-2-15-6-7/h3,5,7,12H,1-2,4,6H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | REXCHUFASCQMBE-ZETCQYMHSA-N |
| XLogP | 1.54 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |