C26H29FN2O3 — CID 93336147
(2R)-2-[[(1S)-2-(cyclopropanecarbonyl)-1-(3-fluorophenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-prop-2-enylbutanamide (PubChem CID 93336147) has the molecular formula C26H29FN2O3 and a molecular weight of 436.53 g/mol. Its IUPAC name is (2R)-2-[[(1S)-2-(cyclopropanecarbonyl)-1-(3-fluorophenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-prop-2-enylbutanamide.
| Compound Name | (2R)-2-[[(1S)-2-(cyclopropanecarbonyl)-1-(3-fluorophenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 93336147 |
| Molecular Formula | C26H29FN2O3 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (2R)-2-[[(1S)-2-(cyclopropanecarbonyl)-1-(3-fluorophenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-prop-2-enylbutanamide |
| SMILES | C=CCNC(=O)[C@@H](CC)Oc1ccc2c(c1)[C@H](c1cccc(F)c1)N(C(=O)C1CC1)CC2 |
| InChI | InChI=1S/C26H29FN2O3/c1-3-13-28-25(30)23(4-2)32-21-11-10-17-12-14-29(26(31)18-8-9-18)24(22(17)16-21)19-6-5-7-20(27)15-19/h3,5-7,10-11,15-16,18,23-24H,1,4,8-9,12-14H2,2H3,(H,28,30)/t23-,24+/m1/s1 |
| InChIKey | MSXJMHKAEHEVLA-RPWUZVMVSA-N |
| XLogP | 4.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|