C18H17N5O4S — CID 9333621
N'-[2-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]sulfanylacetyl]-3-nitrobenzohydrazide (PubChem CID 9333621) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is N'-[2-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]sulfanylacetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]sulfanylacetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 9333621 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N'-[2-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]sulfanylacetyl]-3-nitrobenzohydrazide |
| SMILES | C[C@@H](SCC(=O)NNC(=O)c1cccc([N+](=O)[O-])c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H17N5O4S/c1-11(17-19-14-7-2-3-8-15(14)20-17)28-10-16(24)21-22-18(25)12-5-4-6-13(9-12)23(26)27/h2-9,11H,10H2,1H3,(H,19,20)(H,21,24)(H,22,25)/t11-/m1/s1 |
| InChIKey | FIABQAVMZQDRKE-LLVKDONJSA-N |
| XLogP | 2.73 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|