C22H23ClN2O2 — CID 9335156
ethyl 2-[[[(1S)-1-(4-chlorophenyl)ethyl]amino]methyl]-4-methylquinoline-3-carboxylate (PubChem CID 9335156) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is ethyl 2-[[[(1S)-1-(4-chlorophenyl)ethyl]amino]methyl]-4-methylquinoline-3-carboxylate.
| Compound Name | ethyl 2-[[[(1S)-1-(4-chlorophenyl)ethyl]amino]methyl]-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 9335156 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | ethyl 2-[[[(1S)-1-(4-chlorophenyl)ethyl]amino]methyl]-4-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN[C@@H](C)c2ccc(Cl)cc2)nc2ccccc2c1C |
| InChI | InChI=1S/C22H23ClN2O2/c1-4-27-22(26)21-14(2)18-7-5-6-8-19(18)25-20(21)13-24-15(3)16-9-11-17(23)12-10-16/h5-12,15,24H,4,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | FIXWIURMDBKPQS-HNNXBMFYSA-N |
| XLogP | 5.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |