C20H17F2NO3 — CID 9336653
(E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]-2-(2-methoxybenzoyl)prop-2-enenitrile (PubChem CID 9336653) has the molecular formula C20H17F2NO3 and a molecular weight of 357.36 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]-2-(2-methoxybenzoyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]-2-(2-methoxybenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9336653 |
| Molecular Formula | C20H17F2NO3 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]-2-(2-methoxybenzoyl)prop-2-enenitrile |
| SMILES | COc1ccccc1C(=O)/C(C#N)=C/c1cc(C)c(OC(F)F)c(C)c1 |
| InChI | InChI=1S/C20H17F2NO3/c1-12-8-14(9-13(2)19(12)26-20(21)22)10-15(11-23)18(24)16-6-4-5-7-17(16)25-3/h4-10,20H,1-3H3/b15-10+ |
| InChIKey | OHEKDPGDSYUCEK-XNTDXEJSSA-N |
| XLogP | 4.70 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|