C20H14F2N2O3 — CID 74273782
3-[2-(difluoromethoxy)-3-methoxyphenyl]-2-(1H-indole-3-carbonyl)prop-2-enenitrile (PubChem CID 74273782) has the molecular formula C20H14F2N2O3 and a molecular weight of 368.34 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)-3-methoxyphenyl]-2-(1H-indole-3-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[2-(difluoromethoxy)-3-methoxyphenyl]-2-(1H-indole-3-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 74273782 |
| Molecular Formula | C20H14F2N2O3 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 3-[2-(difluoromethoxy)-3-methoxyphenyl]-2-(1H-indole-3-carbonyl)prop-2-enenitrile |
| SMILES | COc1cccc(C=C(C#N)C(=O)c2c[nH]c3ccccc23)c1OC(F)F |
| InChI | InChI=1S/C20H14F2N2O3/c1-26-17-8-4-5-12(19(17)27-20(21)22)9-13(10-23)18(25)15-11-24-16-7-3-2-6-14(15)16/h2-9,11,20,24H,1H3 |
| InChIKey | VEHZWFHEMFIQSP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|