C17H19NO4 — CID 7972797
prop-2-enyl (E)-2-cyano-3-(3-methoxy-2-propan-2-yloxyphenyl)prop-2-enoate (PubChem CID 7972797) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is prop-2-enyl (E)-2-cyano-3-(3-methoxy-2-propan-2-yloxyphenyl)prop-2-enoate.
| Compound Name | prop-2-enyl (E)-2-cyano-3-(3-methoxy-2-propan-2-yloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7972797 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | prop-2-enyl (E)-2-cyano-3-(3-methoxy-2-propan-2-yloxyphenyl)prop-2-enoate |
| SMILES | C=CCOC(=O)/C(C#N)=C/c1cccc(OC)c1OC(C)C |
| InChI | InChI=1S/C17H19NO4/c1-5-9-21-17(19)14(11-18)10-13-7-6-8-15(20-4)16(13)22-12(2)3/h5-8,10,12H,1,9H2,2-4H3/b14-10+ |
| InChIKey | UJOLFOKYONIHTL-GXDHUFHOSA-N |
| XLogP | 3.12 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|