C18H22N2OS2 — CID 9338142
N-cyclohexyl-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetamide (PubChem CID 9338142) has the molecular formula C18H22N2OS2 and a molecular weight of 346.52 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 9338142 |
| Molecular Formula | C18H22N2OS2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-cyclohexyl-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetamide |
| SMILES | Cc1ccc(-c2csc(=S)n2CC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H22N2OS2/c1-13-7-9-14(10-8-13)16-12-23-18(22)20(16)11-17(21)19-15-5-3-2-4-6-15/h7-10,12,15H,2-6,11H2,1H3,(H,19,21) |
| InChIKey | GBXFJHLYBCGQCC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|