C14H17N3OS2 — CID 9164002
N',N'-dimethyl-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetohydrazide (PubChem CID 9164002) has the molecular formula C14H17N3OS2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N',N'-dimethyl-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetohydrazide.
| Compound Name | N',N'-dimethyl-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 9164002 |
| Molecular Formula | C14H17N3OS2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N',N'-dimethyl-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetohydrazide |
| SMILES | Cc1ccc(-c2csc(=S)n2CC(=O)NN(C)C)cc1 |
| InChI | InChI=1S/C14H17N3OS2/c1-10-4-6-11(7-5-10)12-9-20-14(19)17(12)8-13(18)15-16(2)3/h4-7,9H,8H2,1-3H3,(H,15,18) |
| InChIKey | ZTRXQJIXKDNDRD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|