C20H19N3O2S2 — CID 9220959
2-methyl-N'-[2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetyl]benzohydrazide (PubChem CID 9220959) has the molecular formula C20H19N3O2S2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 2-methyl-N'-[2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetyl]benzohydrazide.
| Compound Name | 2-methyl-N'-[2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9220959 |
| Molecular Formula | C20H19N3O2S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-methyl-N'-[2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetyl]benzohydrazide |
| SMILES | Cc1ccc(-c2csc(=S)n2CC(=O)NNC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C20H19N3O2S2/c1-13-7-9-15(10-8-13)17-12-27-20(26)23(17)11-18(24)21-22-19(25)16-6-4-3-5-14(16)2/h3-10,12H,11H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | GNWJPSGLNCLIRL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|