C19H18N2O2S2 — CID 9412036
N-(4-methoxyphenyl)-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetamide (PubChem CID 9412036) has the molecular formula C19H18N2O2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 9412036 |
| Molecular Formula | C19H18N2O2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c(-c3ccc(C)cc3)csc2=S)cc1 |
| InChI | InChI=1S/C19H18N2O2S2/c1-13-3-5-14(6-4-13)17-12-25-19(24)21(17)11-18(22)20-15-7-9-16(23-2)10-8-15/h3-10,12H,11H2,1-2H3,(H,20,22) |
| InChIKey | CQXBFOIVNZUGGU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|