C24H27N3O2S2 — CID 24549613
2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide (PubChem CID 24549613) has the molecular formula C24H27N3O2S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 24549613 |
| Molecular Formula | C24H27N3O2S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide |
| SMILES | Cc1ccc(-c2csc(=S)n2CC(=O)NCc2ccc(CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O2S2/c1-18-2-8-21(9-3-18)22-17-31-24(30)27(22)16-23(28)25-14-19-4-6-20(7-5-19)15-26-10-12-29-13-11-26/h2-9,17H,10-16H2,1H3,(H,25,28) |
| InChIKey | JZRUSNRRHBTOBC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|