C20H24N3O6+ — CID 9338299
2-(4-methoxy-2-nitrophenoxy)-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]acetamide (PubChem CID 9338299) has the molecular formula C20H24N3O6+ and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-(4-methoxy-2-nitrophenoxy)-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(4-methoxy-2-nitrophenoxy)-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9338299 |
| Molecular Formula | C20H24N3O6+ |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-(4-methoxy-2-nitrophenoxy)-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]acetamide |
| SMILES | COc1ccc(OCC(=O)Nc2ccc(C[NH+]3CCOCC3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H23N3O6/c1-27-17-6-7-19(18(12-17)23(25)26)29-14-20(24)21-16-4-2-15(3-5-16)13-22-8-10-28-11-9-22/h2-7,12H,8-11,13-14H2,1H3,(H,21,24)/p+1 |
| InChIKey | NVFNIMDUTGNTSI-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|