C14H17BrClNO3 — CID 9338818
2-(4-bromo-2-chloro-6-methylphenoxy)-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 9338818) has the molecular formula C14H17BrClNO3 and a molecular weight of 362.65 g/mol. Its IUPAC name is 2-(4-bromo-2-chloro-6-methylphenoxy)-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-(4-bromo-2-chloro-6-methylphenoxy)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 9338818 |
| Molecular Formula | C14H17BrClNO3 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-(4-bromo-2-chloro-6-methylphenoxy)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | Cc1cc(Br)cc(Cl)c1OCC(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C14H17BrClNO3/c1-9-5-10(15)6-12(16)14(9)20-8-13(18)17-7-11-3-2-4-19-11/h5-6,11H,2-4,7-8H2,1H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | WYPPJWULIWKMDT-LLVKDONJSA-N |
| XLogP | 3.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |