C12H16FN3O2 — CID 93454050
trans-(1R,2R)-2-N-(3-fluoro-2-nitrophenyl)cyclohexane-1,2-diamine (PubChem CID 93454050) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-(3-fluoro-2-nitrophenyl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-2-N-(3-fluoro-2-nitrophenyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 93454050 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | trans-(1R,2R)-2-N-(3-fluoro-2-nitrophenyl)cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@H]1Nc1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16FN3O2/c13-8-4-3-7-11(12(8)16(17)18)15-10-6-2-1-5-9(10)14/h3-4,7,9-10,15H,1-2,5-6,14H2/t9-,10-/m1/s1 |
| InChIKey | YUXRTWCGJGMCCY-NXEZZACHSA-N |
| XLogP | 2.42 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|