C15H24N2 — CID 93464451
1-[(1S)-1-(2,4,6-trimethylphenyl)ethyl]piperazine (PubChem CID 93464451) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4,6-trimethylphenyl)ethyl]piperazine.
| Compound Name | 1-[(1S)-1-(2,4,6-trimethylphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 93464451 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-[(1S)-1-(2,4,6-trimethylphenyl)ethyl]piperazine |
| SMILES | Cc1cc(C)c([C@H](C)N2CCNCC2)c(C)c1 |
| InChI | InChI=1S/C15H24N2/c1-11-9-12(2)15(13(3)10-11)14(4)17-7-5-16-6-8-17/h9-10,14,16H,5-8H2,1-4H3/t14-/m0/s1 |
| InChIKey | SHMVNWMUPHPQSO-AWEZNQCLSA-N |
| XLogP | 2.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |