C21H21N3O3S2 — CID 93487007
(2S)-2-benzylsulfanyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]propanamide (PubChem CID 93487007) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-2-benzylsulfanyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]propanamide.
| Compound Name | (2S)-2-benzylsulfanyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 93487007 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (2S)-2-benzylsulfanyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]propanamide |
| SMILES | C[C@H](SCc1ccccc1)C(=O)Nc1ccc(S(=O)(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C21H21N3O3S2/c1-16(28-15-17-6-3-2-4-7-17)21(25)23-18-9-11-20(12-10-18)29(26,27)24-19-8-5-13-22-14-19/h2-14,16,24H,15H2,1H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | TULRLUAUXRKZBA-INIZCTEOSA-N |
| XLogP | 4.14 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |