C16H22F4O3 — CID 93492444
(2R)-1-[4-[(2R)-butan-2-yl]phenoxy]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 93492444) has the molecular formula C16H22F4O3 and a molecular weight of 338.34 g/mol. Its IUPAC name is (2R)-1-[4-[(2R)-butan-2-yl]phenoxy]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | (2R)-1-[4-[(2R)-butan-2-yl]phenoxy]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 93492444 |
| Molecular Formula | C16H22F4O3 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (2R)-1-[4-[(2R)-butan-2-yl]phenoxy]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | CC[C@@H](C)c1ccc(OC[C@H](O)COCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C16H22F4O3/c1-3-11(2)12-4-6-14(7-5-12)23-9-13(21)8-22-10-16(19,20)15(17)18/h4-7,11,13,15,21H,3,8-10H2,1-2H3/t11-,13-/m1/s1 |
| InChIKey | CJBQJVABOFLHNY-DGCLKSJQSA-N |
| XLogP | 3.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|