C6H9ClO — CID 93494094
2-chloro-1-[(1S,2S)-2-methylcyclopropyl]ethanone (PubChem CID 93494094) has the molecular formula C6H9ClO and a molecular weight of 132.59 g/mol. Its IUPAC name is 2-chloro-1-[(1S,2S)-2-methylcyclopropyl]ethanone.
| Compound Name | 2-chloro-1-[(1S,2S)-2-methylcyclopropyl]ethanone |
|---|---|
| PubChem CID | 93494094 |
| Molecular Formula | C6H9ClO |
| Molecular Weight | 132.59 g/mol |
| Exact Mass | 132.03 |
| IUPAC Name | 2-chloro-1-[(1S,2S)-2-methylcyclopropyl]ethanone |
| SMILES | C[C@H]1C[C@@H]1C(=O)CCl |
| InChI | InChI=1S/C6H9ClO/c1-4-2-5(4)6(8)3-7/h4-5H,2-3H2,1H3/t4-,5-/m0/s1 |
| InChIKey | HVRRRVQDZJXREN-WHFBIAKZSA-N |
| XLogP | 1.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.59 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|