C8H5F2N3S — CID 935312
5-(2,6-difluorophenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 935312) has the molecular formula C8H5F2N3S and a molecular weight of 213.21 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2,6-difluorophenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 935312 |
| Molecular Formula | C8H5F2N3S |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 5-(2,6-difluorophenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2c(F)cccc2F)s1 |
| InChI | InChI=1S/C8H5F2N3S/c9-4-2-1-3-5(10)6(4)7-12-13-8(11)14-7/h1-3H,(H2,11,13) |
| InChIKey | DHXTUPRTHLDAID-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |